About 3-(ethoxymethyl)heptane
3-(ethoxymethyl)heptane (PubChem CID 21252455) has the molecular formula C10H22O
and a molecular weight of 158.28 g/mol. Its IUPAC name is 3-(ethoxymethyl)heptane.
Molecular Properties
| Compound Name | 3-(ethoxymethyl)heptane |
| PubChem CID | 21252455 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | 3-(ethoxymethyl)heptane |
| SMILES | CCCCC(CC)COCC |
| InChI | InChI=1S/C10H22O/c1-4-7-8-10(5-2)9-11-6-3/h10H,4-9H2,1-3H3 |
| InChIKey | GUWMIMDSGCRWSR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(ethoxymethyl)heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethoxymethyl)heptane?
The IUPAC name of 3-(ethoxymethyl)heptane (CID 21252455) is 3-(ethoxymethyl)heptane.
What is the SMILES notation for 3-(ethoxymethyl)heptane?
The canonical SMILES for 3-(ethoxymethyl)heptane is CCCCC(CC)COCC.
What is the InChIKey of 3-(ethoxymethyl)heptane?
The InChIKey is GUWMIMDSGCRWSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O/c1-4-7-8-10(5-2)9-11-6-3/h10H,4-9H2,1-3H3.
What are the key properties of 3-(ethoxymethyl)heptane?
3-(ethoxymethyl)heptane has a molecular weight of 158.28 g/mol, XLogP of 3.24, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethoxymethyl)heptane is sourced from PubChem (CID 21252455), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).