About 11a,11b-dihydro-11H-benzo[a]quinolizine
11a,11b-dihydro-11H-benzo[a]quinolizine (PubChem CID 21252522) has the molecular formula C13H13N
and a molecular weight of 183.25 g/mol. Its IUPAC name is 11a,11b-dihydro-11H-benzo[a]quinolizine.
Molecular Properties
| Compound Name | 11a,11b-dihydro-11H-benzo[a]quinolizine |
| PubChem CID | 21252522 |
| Molecular Formula | C13H13N |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.10 |
| IUPAC Name | 11a,11b-dihydro-11H-benzo[a]quinolizine |
| SMILES | C1=CCC2C(=C1)C=CN1C=CC=CC21 |
| InChI | InChI=1S/C13H13N/c1-2-6-12-11(5-1)8-10-14-9-4-3-7-13(12)14/h1-5,7-10,12-13H,6H2 |
| InChIKey | HQLSHBDOIUUPHG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 11a,11b-dihydro-11H-benzo[a]quinolizine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11a,11b-dihydro-11H-benzo[a]quinolizine?
The IUPAC name of 11a,11b-dihydro-11H-benzo[a]quinolizine (CID 21252522) is 11a,11b-dihydro-11H-benzo[a]quinolizine.
What is the SMILES notation for 11a,11b-dihydro-11H-benzo[a]quinolizine?
The canonical SMILES for 11a,11b-dihydro-11H-benzo[a]quinolizine is C1=CCC2C(=C1)C=CN1C=CC=CC21.
What is the InChIKey of 11a,11b-dihydro-11H-benzo[a]quinolizine?
The InChIKey is HQLSHBDOIUUPHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N/c1-2-6-12-11(5-1)8-10-14-9-4-3-7-13(12)14/h1-5,7-10,12-13H,6H2.
What are the key properties of 11a,11b-dihydro-11H-benzo[a]quinolizine?
11a,11b-dihydro-11H-benzo[a]quinolizine has a molecular weight of 183.25 g/mol, XLogP of 2.77, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11a,11b-dihydro-11H-benzo[a]quinolizine is sourced from PubChem (CID 21252522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).