About 4-(1,1-difluoropropan-2-yl)cyclohexan-1-ol
4-(1,1-difluoropropan-2-yl)cyclohexan-1-ol (PubChem CID 21252718) has the molecular formula C9H16F2O
and a molecular weight of 178.22 g/mol. Its IUPAC name is 4-(1,1-difluoropropan-2-yl)cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-(1,1-difluoropropan-2-yl)cyclohexan-1-ol |
| PubChem CID | 21252718 |
| Molecular Formula | C9H16F2O |
| Molecular Weight | 178.22 g/mol |
| Exact Mass | 178.12 |
| IUPAC Name | 4-(1,1-difluoropropan-2-yl)cyclohexan-1-ol |
| SMILES | CC(C(F)F)C1CCC(O)CC1 |
| InChI | InChI=1S/C9H16F2O/c1-6(9(10)11)7-2-4-8(12)5-3-7/h6-9,12H,2-5H2,1H3 |
| InChIKey | PTKJBXOXAVGXSO-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(1,1-difluoropropan-2-yl)cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-difluoropropan-2-yl)cyclohexan-1-ol?
The IUPAC name of 4-(1,1-difluoropropan-2-yl)cyclohexan-1-ol (CID 21252718) is 4-(1,1-difluoropropan-2-yl)cyclohexan-1-ol.
What is the SMILES notation for 4-(1,1-difluoropropan-2-yl)cyclohexan-1-ol?
The canonical SMILES for 4-(1,1-difluoropropan-2-yl)cyclohexan-1-ol is CC(C(F)F)C1CCC(O)CC1.
What is the InChIKey of 4-(1,1-difluoropropan-2-yl)cyclohexan-1-ol?
The InChIKey is PTKJBXOXAVGXSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2O/c1-6(9(10)11)7-2-4-8(12)5-3-7/h6-9,12H,2-5H2,1H3.
What are the key properties of 4-(1,1-difluoropropan-2-yl)cyclohexan-1-ol?
4-(1,1-difluoropropan-2-yl)cyclohexan-1-ol has a molecular weight of 178.22 g/mol, XLogP of 2.44, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-difluoropropan-2-yl)cyclohexan-1-ol is sourced from PubChem (CID 21252718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).