C17H15NO3 — CID 21252815
7,12-dimethoxy-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-4-one (PubChem CID 21252815) has the molecular formula C17H15NO3 and a molecular weight of 281.31 g/mol. Its IUPAC name is 7,12-dimethoxy-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-4-one.
| Compound Name | 7,12-dimethoxy-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-4-one |
|---|---|
| PubChem CID | 21252815 |
| Molecular Formula | C17H15NO3 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 7,12-dimethoxy-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-4-one |
| SMILES | COc1ccc2c(c1)c1cc(OC)cc3c1n2CCC3=O |
| InChI | InChI=1S/C17H15NO3/c1-20-10-3-4-15-12(7-10)13-8-11(21-2)9-14-16(19)5-6-18(15)17(13)14/h3-4,7-9H,5-6H2,1-2H3 |
| InChIKey | IVWPYWJIKDDRSZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |