C23H18N2O3 — CID 21252851
7,12-dimethoxy-3-(pyridin-3-ylmethyl)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9(16),10(15),11,13-heptaen-4-one (PubChem CID 21252851) has the molecular formula C23H18N2O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is 7,12-dimethoxy-3-(pyridin-3-ylmethyl)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9(16),10(15),11,13-heptaen-4-one.
| Compound Name | 7,12-dimethoxy-3-(pyridin-3-ylmethyl)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9(16),10(15),11,13-heptaen-4-one |
|---|---|
| PubChem CID | 21252851 |
| Molecular Formula | C23H18N2O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.13 |
| IUPAC Name | 7,12-dimethoxy-3-(pyridin-3-ylmethyl)-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-2,5,7,9(16),10(15),11,13-heptaen-4-one |
| SMILES | COc1ccc2c(c1)c1cc(OC)cc3c(=O)c(Cc4cccnc4)cn2c31 |
| InChI | InChI=1S/C23H18N2O3/c1-27-16-5-6-21-18(9-16)19-10-17(28-2)11-20-22(19)25(21)13-15(23(20)26)8-14-4-3-7-24-12-14/h3-7,9-13H,8H2,1-2H3 |
| InChIKey | BQAXRWCDNVUGFZ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |