About 2-ethoxybutanedinitrile
2-ethoxybutanedinitrile (PubChem CID 21253561) has the molecular formula C6H8N2O
and a molecular weight of 124.14 g/mol. Its IUPAC name is 2-ethoxybutanedinitrile.
Molecular Properties
| Compound Name | 2-ethoxybutanedinitrile |
| PubChem CID | 21253561 |
| Molecular Formula | C6H8N2O |
| Molecular Weight | 124.14 g/mol |
| Exact Mass | 124.06 |
| IUPAC Name | 2-ethoxybutanedinitrile |
| SMILES | CCOC(C#N)CC#N |
| InChI | InChI=1S/C6H8N2O/c1-2-9-6(5-8)3-4-7/h6H,2-3H2,1H3 |
| InChIKey | ZPZUEGOXASKMRT-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.14 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethoxybutanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxybutanedinitrile?
The IUPAC name of 2-ethoxybutanedinitrile (CID 21253561) is 2-ethoxybutanedinitrile.
What is the SMILES notation for 2-ethoxybutanedinitrile?
The canonical SMILES for 2-ethoxybutanedinitrile is CCOC(C#N)CC#N.
What is the InChIKey of 2-ethoxybutanedinitrile?
The InChIKey is ZPZUEGOXASKMRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O/c1-2-9-6(5-8)3-4-7/h6H,2-3H2,1H3.
What are the key properties of 2-ethoxybutanedinitrile?
2-ethoxybutanedinitrile has a molecular weight of 124.14 g/mol, XLogP of 0.83, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxybutanedinitrile is sourced from PubChem (CID 21253561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).