C34H42N4O4S — CID 21254068
N-[4-[4-[2-[2-(3,5-dimethylphenyl)-5-(morpholine-4-carbonyl)-1H-indol-3-yl]ethylamino]butyl]phenyl]methanesulfonamide (PubChem CID 21254068) has the molecular formula C34H42N4O4S and a molecular weight of 602.80 g/mol. Its IUPAC name is N-[4-[4-[2-[2-(3,5-dimethylphenyl)-5-(morpholine-4-carbonyl)-1H-indol-3-yl]ethylamino]butyl]phenyl]methanesulfonamide.
| Compound Name | N-[4-[4-[2-[2-(3,5-dimethylphenyl)-5-(morpholine-4-carbonyl)-1H-indol-3-yl]ethylamino]butyl]phenyl]methanesulfonamide |
|---|---|
| PubChem CID | 21254068 |
| Molecular Formula | C34H42N4O4S |
| Molecular Weight | 602.80 g/mol |
| Exact Mass | 602.29 |
| IUPAC Name | N-[4-[4-[2-[2-(3,5-dimethylphenyl)-5-(morpholine-4-carbonyl)-1H-indol-3-yl]ethylamino]butyl]phenyl]methanesulfonamide |
| SMILES | Cc1cc(C)cc(-c2[nH]c3ccc(C(=O)N4CCOCC4)cc3c2CCNCCCCc2ccc(NS(C)(=O)=O)cc2)c1 |
| InChI | InChI=1S/C34H42N4O4S/c1-24-20-25(2)22-28(21-24)33-30(31-23-27(9-12-32(31)36-33)34(39)38-16-18-42-19-17-38)13-15-35-14-5-4-6-26-7-10-29(11-8-26)37-43(3,40)41/h7-12,20-23,35-37H,4-6,13-19H2,1-3H3 |
| InChIKey | FUNSVWNYPBWHOX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.80 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|