About (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-(2-hydroxyphenyl)methanone
(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-(2-hydroxyphenyl)methanone (PubChem CID 2125445) has the molecular formula C15H13N3O2
and a molecular weight of 267.29 g/mol. Its IUPAC name is (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-(2-hydroxyphenyl)methanone.
Molecular Properties
| Compound Name | (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-(2-hydroxyphenyl)methanone |
| PubChem CID | 2125445 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-(2-hydroxyphenyl)methanone |
| SMILES | Cc1nn(C)c2ncc(C(=O)c3ccccc3O)cc12 |
| InChI | InChI=1S/C15H13N3O2/c1-9-12-7-10(8-16-15(12)18(2)17-9)14(20)11-5-3-4-6-13(11)19/h3-8,19H,1-2H3 |
| InChIKey | SESHLMXKXMBICK-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-(2-hydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-(2-hydroxyphenyl)methanone?
The IUPAC name of (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-(2-hydroxyphenyl)methanone (CID 2125445) is (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-(2-hydroxyphenyl)methanone.
What is the SMILES notation for (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-(2-hydroxyphenyl)methanone?
The canonical SMILES for (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-(2-hydroxyphenyl)methanone is Cc1nn(C)c2ncc(C(=O)c3ccccc3O)cc12.
What is the InChIKey of (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-(2-hydroxyphenyl)methanone?
The InChIKey is SESHLMXKXMBICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3O2/c1-9-12-7-10(8-16-15(12)18(2)17-9)14(20)11-5-3-4-6-13(11)19/h3-8,19H,1-2H3.
What are the key properties of (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-(2-hydroxyphenyl)methanone?
(1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-(2-hydroxyphenyl)methanone has a molecular weight of 267.29 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dimethylpyrazolo[5,4-b]pyridin-5-yl)-(2-hydroxyphenyl)methanone is sourced from PubChem (CID 2125445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).