C10H22N2O+2 — CID 21254458
1,1,4-trimethyl-4-(oxiran-2-ylmethyl)piperazine-1,4-diium (PubChem CID 21254458) has the molecular formula C10H22N2O+2 and a molecular weight of 186.30 g/mol. Its IUPAC name is 1,1,4-trimethyl-4-(oxiran-2-ylmethyl)piperazine-1,4-diium.
| Compound Name | 1,1,4-trimethyl-4-(oxiran-2-ylmethyl)piperazine-1,4-diium |
|---|---|
| PubChem CID | 21254458 |
| Molecular Formula | C10H22N2O+2 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | 1,1,4-trimethyl-4-(oxiran-2-ylmethyl)piperazine-1,4-diium |
| SMILES | C[N+]1(C)CC[N+](C)(CC2CO2)CC1 |
| InChI | InChI=1S/C10H22N2O/c1-11(2)4-6-12(3,7-5-11)8-10-9-13-10/h10H,4-9H2,1-3H3/q+2 |
| InChIKey | JEGRUGGQQAMHHB-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|