C7H19Cl3N2 — CID 21254468
N-(2-chloroethyl)-N',N'-dimethylpropane-1,3-diamine;dihydrochloride (PubChem CID 21254468) has the molecular formula C7H19Cl3N2 and a molecular weight of 237.60 g/mol. Its IUPAC name is N-(2-chloroethyl)-N',N'-dimethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N-(2-chloroethyl)-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 21254468 |
| Molecular Formula | C7H19Cl3N2 |
| Molecular Weight | 237.60 g/mol |
| Exact Mass | 236.06 |
| IUPAC Name | N-(2-chloroethyl)-N',N'-dimethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CN(C)CCCNCCCl.Cl.Cl |
| InChI | InChI=1S/C7H17ClN2.2ClH/c1-10(2)7-3-5-9-6-4-8;;/h9H,3-7H2,1-2H3;2*1H |
| InChIKey | IOSZGHHKMMMTKB-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.60 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|