About 7-methoxy-N,N,10-trimethylphenothiazin-3-amine
7-methoxy-N,N,10-trimethylphenothiazin-3-amine (PubChem CID 21254490) has the molecular formula C16H18N2OS
and a molecular weight of 286.40 g/mol. Its IUPAC name is 7-methoxy-N,N,10-trimethylphenothiazin-3-amine.
Molecular Properties
| Compound Name | 7-methoxy-N,N,10-trimethylphenothiazin-3-amine |
| PubChem CID | 21254490 |
| Molecular Formula | C16H18N2OS |
| Molecular Weight | 286.40 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 7-methoxy-N,N,10-trimethylphenothiazin-3-amine |
| SMILES | COc1ccc2c(c1)Sc1cc(N(C)C)ccc1N2C |
| InChI | InChI=1S/C16H18N2OS/c1-17(2)11-5-7-13-15(9-11)20-16-10-12(19-4)6-8-14(16)18(13)3/h5-10H,1-4H3 |
| InChIKey | NJSPPECWSHBLKO-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methoxy-N,N,10-trimethylphenothiazin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methoxy-N,N,10-trimethylphenothiazin-3-amine?
The IUPAC name of 7-methoxy-N,N,10-trimethylphenothiazin-3-amine (CID 21254490) is 7-methoxy-N,N,10-trimethylphenothiazin-3-amine.
What is the SMILES notation for 7-methoxy-N,N,10-trimethylphenothiazin-3-amine?
The canonical SMILES for 7-methoxy-N,N,10-trimethylphenothiazin-3-amine is COc1ccc2c(c1)Sc1cc(N(C)C)ccc1N2C.
What is the InChIKey of 7-methoxy-N,N,10-trimethylphenothiazin-3-amine?
The InChIKey is NJSPPECWSHBLKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2OS/c1-17(2)11-5-7-13-15(9-11)20-16-10-12(19-4)6-8-14(16)18(13)3/h5-10H,1-4H3.
What are the key properties of 7-methoxy-N,N,10-trimethylphenothiazin-3-amine?
7-methoxy-N,N,10-trimethylphenothiazin-3-amine has a molecular weight of 286.40 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methoxy-N,N,10-trimethylphenothiazin-3-amine is sourced from PubChem (CID 21254490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).