About N-[3-(bromomethyl)-2,4-dichlorophenyl]-N-methylacetamide
N-[3-(bromomethyl)-2,4-dichlorophenyl]-N-methylacetamide (PubChem CID 21254728) has the molecular formula C10H10BrCl2NO
and a molecular weight of 311.01 g/mol. Its IUPAC name is N-[3-(bromomethyl)-2,4-dichlorophenyl]-N-methylacetamide.
Molecular Properties
| Compound Name | N-[3-(bromomethyl)-2,4-dichlorophenyl]-N-methylacetamide |
| PubChem CID | 21254728 |
| Molecular Formula | C10H10BrCl2NO |
| Molecular Weight | 311.01 g/mol |
| Exact Mass | 308.93 |
| IUPAC Name | N-[3-(bromomethyl)-2,4-dichlorophenyl]-N-methylacetamide |
| SMILES | CC(=O)N(C)c1ccc(Cl)c(CBr)c1Cl |
| InChI | InChI=1S/C10H10BrCl2NO/c1-6(15)14(2)9-4-3-8(12)7(5-11)10(9)13/h3-4H,5H2,1-2H3 |
| InChIKey | FHIPRJKHLXWKNY-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.01 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[3-(bromomethyl)-2,4-dichlorophenyl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-(bromomethyl)-2,4-dichlorophenyl]-N-methylacetamide?
The IUPAC name of N-[3-(bromomethyl)-2,4-dichlorophenyl]-N-methylacetamide (CID 21254728) is N-[3-(bromomethyl)-2,4-dichlorophenyl]-N-methylacetamide.
What is the SMILES notation for N-[3-(bromomethyl)-2,4-dichlorophenyl]-N-methylacetamide?
The canonical SMILES for N-[3-(bromomethyl)-2,4-dichlorophenyl]-N-methylacetamide is CC(=O)N(C)c1ccc(Cl)c(CBr)c1Cl.
What is the InChIKey of N-[3-(bromomethyl)-2,4-dichlorophenyl]-N-methylacetamide?
The InChIKey is FHIPRJKHLXWKNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrCl2NO/c1-6(15)14(2)9-4-3-8(12)7(5-11)10(9)13/h3-4H,5H2,1-2H3.
What are the key properties of N-[3-(bromomethyl)-2,4-dichlorophenyl]-N-methylacetamide?
N-[3-(bromomethyl)-2,4-dichlorophenyl]-N-methylacetamide has a molecular weight of 311.01 g/mol, XLogP of 3.87, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-(bromomethyl)-2,4-dichlorophenyl]-N-methylacetamide is sourced from PubChem (CID 21254728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).