C18H23N5O2 — CID 21255106
2,2-dimethyl-N-[4-(5-oxidoimidazo[4,5-c][1,5]naphthyridin-5-ium-1-yl)butyl]propanamide (PubChem CID 21255106) has the molecular formula C18H23N5O2 and a molecular weight of 341.42 g/mol. Its IUPAC name is 2,2-dimethyl-N-[4-(5-oxidoimidazo[4,5-c][1,5]naphthyridin-5-ium-1-yl)butyl]propanamide.
| Compound Name | 2,2-dimethyl-N-[4-(5-oxidoimidazo[4,5-c][1,5]naphthyridin-5-ium-1-yl)butyl]propanamide |
|---|---|
| PubChem CID | 21255106 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.42 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 2,2-dimethyl-N-[4-(5-oxidoimidazo[4,5-c][1,5]naphthyridin-5-ium-1-yl)butyl]propanamide |
| SMILES | CC(C)(C)C(=O)NCCCCn1cnc2c[n+]([O-])c3cccnc3c21 |
| InChI | InChI=1S/C18H23N5O2/c1-18(2,3)17(24)20-8-4-5-10-22-12-21-13-11-23(25)14-7-6-9-19-15(14)16(13)22/h6-7,9,11-12H,4-5,8,10H2,1-3H3,(H,20,24) |
| InChIKey | FIJRKBQQDIJBIP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.42 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|