C20H16O4 — CID 21255420
9-benzyl-9H-fluorene-2,3,6,7-tetrol (PubChem CID 21255420) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is 9-benzyl-9H-fluorene-2,3,6,7-tetrol.
| Compound Name | 9-benzyl-9H-fluorene-2,3,6,7-tetrol |
|---|---|
| PubChem CID | 21255420 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 9-benzyl-9H-fluorene-2,3,6,7-tetrol |
| SMILES | Oc1cc2c(cc1O)C(Cc1ccccc1)c1cc(O)c(O)cc1-2 |
| InChI | InChI=1S/C20H16O4/c21-17-7-13-12(6-11-4-2-1-3-5-11)14-8-18(22)20(24)10-16(14)15(13)9-19(17)23/h1-5,7-10,12,21-24H,6H2 |
| InChIKey | CJYFCWFCOIUEJO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|