About 3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-4-methylbenzoate
3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-4-methylbenzoate (PubChem CID 2125591) has the molecular formula C12H9N4O5-
and a molecular weight of 289.23 g/mol. Its IUPAC name is 3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-4-methylbenzoate.
Molecular Properties
| Compound Name | 3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-4-methylbenzoate |
| PubChem CID | 2125591 |
| Molecular Formula | C12H9N4O5- |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)[O-])cc1/N=N/c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H10N4O5/c1-5-2-3-6(11(19)20)4-7(5)15-16-8-9(17)13-12(21)14-10(8)18/h2-4H,1H3,(H,19,20)(H3,13,14,17,18,21)/p-1/b16-15+ |
| InChIKey | NNYGOOHTZILSIG-FOCLMDBBSA-M |
| XLogP | -0.14 |
| TPSA | 150.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-4-methylbenzoate?
The IUPAC name of 3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-4-methylbenzoate (CID 2125591) is 3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-4-methylbenzoate.
What is the SMILES notation for 3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-4-methylbenzoate?
The canonical SMILES for 3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-4-methylbenzoate is Cc1ccc(C(=O)[O-])cc1/N=N/c1c(O)[nH]c(=O)[nH]c1=O.
What is the InChIKey of 3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-4-methylbenzoate?
The InChIKey is NNYGOOHTZILSIG-FOCLMDBBSA-M. The full InChI is InChI=1S/C12H10N4O5/c1-5-2-3-6(11(19)20)4-7(5)15-16-8-9(17)13-12(21)14-10(8)18/h2-4H,1H3,(H,19,20)(H3,13,14,17,18,21)/p-1/b16-15+.
What are the key properties of 3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-4-methylbenzoate?
3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-4-methylbenzoate has a molecular weight of 289.23 g/mol, XLogP of -0.14, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-hydroxy-2,4-dioxo-1H-pyrimidin-5-yl)diazenyl]-4-methylbenzoate is sourced from PubChem (CID 2125591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).