C24H23F3O5S — CID 21256004
methyl 4-[1-[5,5,7-trimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate (PubChem CID 21256004) has the molecular formula C24H23F3O5S and a molecular weight of 480.50 g/mol. Its IUPAC name is methyl 4-[1-[5,5,7-trimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate.
| Compound Name | methyl 4-[1-[5,5,7-trimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate |
|---|---|
| PubChem CID | 21256004 |
| Molecular Formula | C24H23F3O5S |
| Molecular Weight | 480.50 g/mol |
| Exact Mass | 480.12 |
| IUPAC Name | methyl 4-[1-[5,5,7-trimethyl-8-(trifluoromethylsulfonyloxy)-6H-naphthalen-2-yl]ethenyl]benzoate |
| SMILES | C=C(c1ccc(C(=O)OC)cc1)c1ccc2c(c1)C(OS(=O)(=O)C(F)(F)F)=C(C)CC2(C)C |
| InChI | InChI=1S/C24H23F3O5S/c1-14-13-23(3,4)20-11-10-18(12-19(20)21(14)32-33(29,30)24(25,26)27)15(2)16-6-8-17(9-7-16)22(28)31-5/h6-12H,2,13H2,1,3-5H3 |
| InChIKey | CHVKDIPBXZLSNJ-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.50 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|