C20H20ClN3O2 — CID 21256211
2-[3-benzyl-5-chloro-2-[2-(dimethylamino)phenyl]imidazol-4-yl]acetic acid (PubChem CID 21256211) has the molecular formula C20H20ClN3O2 and a molecular weight of 369.85 g/mol. Its IUPAC name is 2-[3-benzyl-5-chloro-2-[2-(dimethylamino)phenyl]imidazol-4-yl]acetic acid.
| Compound Name | 2-[3-benzyl-5-chloro-2-[2-(dimethylamino)phenyl]imidazol-4-yl]acetic acid |
|---|---|
| PubChem CID | 21256211 |
| Molecular Formula | C20H20ClN3O2 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 2-[3-benzyl-5-chloro-2-[2-(dimethylamino)phenyl]imidazol-4-yl]acetic acid |
| SMILES | CN(C)c1ccccc1-c1nc(Cl)c(CC(=O)O)n1Cc1ccccc1 |
| InChI | InChI=1S/C20H20ClN3O2/c1-23(2)16-11-7-6-10-15(16)20-22-19(21)17(12-18(25)26)24(20)13-14-8-4-3-5-9-14/h3-11H,12-13H2,1-2H3,(H,25,26) |
| InChIKey | YPQAZLKWBCJJLI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |