About (6-fluoro-2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)methanol
(6-fluoro-2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)methanol (PubChem CID 21256466) has the molecular formula C11H9FN2OS
and a molecular weight of 236.27 g/mol. Its IUPAC name is (6-fluoro-2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)methanol.
Molecular Properties
| Compound Name | (6-fluoro-2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)methanol |
| PubChem CID | 21256466 |
| Molecular Formula | C11H9FN2OS |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | (6-fluoro-2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)methanol |
| SMILES | Cc1nc2sc3cc(F)ccc3n2c1CO |
| InChI | InChI=1S/C11H9FN2OS/c1-6-9(5-15)14-8-3-2-7(12)4-10(8)16-11(14)13-6/h2-4,15H,5H2,1H3 |
| InChIKey | XZLBDRLOWONMKD-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (6-fluoro-2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-fluoro-2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)methanol?
The IUPAC name of (6-fluoro-2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)methanol (CID 21256466) is (6-fluoro-2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)methanol.
What is the SMILES notation for (6-fluoro-2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)methanol?
The canonical SMILES for (6-fluoro-2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)methanol is Cc1nc2sc3cc(F)ccc3n2c1CO.
What is the InChIKey of (6-fluoro-2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)methanol?
The InChIKey is XZLBDRLOWONMKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9FN2OS/c1-6-9(5-15)14-8-3-2-7(12)4-10(8)16-11(14)13-6/h2-4,15H,5H2,1H3.
What are the key properties of (6-fluoro-2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)methanol?
(6-fluoro-2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)methanol has a molecular weight of 236.27 g/mol, XLogP of 2.49, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (6-fluoro-2-methylimidazo[2,1-b][1,3]benzothiazol-1-yl)methanol is sourced from PubChem (CID 21256466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).