C9H8N2OS — CID 21256485
7-thia-1,9-diazatricyclo[6.3.0.02,6]undeca-2(6),8,10-triene-11-carbaldehyde (PubChem CID 21256485) has the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. Its IUPAC name is 7-thia-1,9-diazatricyclo[6.3.0.02,6]undeca-2(6),8,10-triene-11-carbaldehyde.
| Compound Name | 7-thia-1,9-diazatricyclo[6.3.0.02,6]undeca-2(6),8,10-triene-11-carbaldehyde |
|---|---|
| PubChem CID | 21256485 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 7-thia-1,9-diazatricyclo[6.3.0.02,6]undeca-2(6),8,10-triene-11-carbaldehyde |
| SMILES | O=Cc1cnc2sc3c(n12)CCC3 |
| InChI | InChI=1S/C9H8N2OS/c12-5-6-4-10-9-11(6)7-2-1-3-8(7)13-9/h4-5H,1-3H2 |
| InChIKey | YLLAMIJOKRGGOQ-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|