C11H13NOS — CID 21256529
2,6,7-trimethyl-4H-1,4-benzoxazine-3-thione (PubChem CID 21256529) has the molecular formula C11H13NOS and a molecular weight of 207.30 g/mol. Its IUPAC name is 2,6,7-trimethyl-4H-1,4-benzoxazine-3-thione.
| Compound Name | 2,6,7-trimethyl-4H-1,4-benzoxazine-3-thione |
|---|---|
| PubChem CID | 21256529 |
| Molecular Formula | C11H13NOS |
| Molecular Weight | 207.30 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 2,6,7-trimethyl-4H-1,4-benzoxazine-3-thione |
| SMILES | Cc1cc2c(cc1C)OC(C)C(=S)N2 |
| InChI | InChI=1S/C11H13NOS/c1-6-4-9-10(5-7(6)2)13-8(3)11(14)12-9/h4-5,8H,1-3H3,(H,12,14) |
| InChIKey | FFICYIYQLLNUJK-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.30 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|