C20H16N4O2 — CID 2125675
N-(furan-2-ylmethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide (PubChem CID 2125675) has the molecular formula C20H16N4O2 and a molecular weight of 344.37 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(furan-2-ylmethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 2125675 |
| Molecular Formula | C20H16N4O2 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | N-(furan-2-ylmethyl)-1,5-diphenyl-1,2,4-triazole-3-carboxamide |
| SMILES | O=C(NCc1ccco1)c1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H16N4O2/c25-20(21-14-17-12-7-13-26-17)18-22-19(15-8-3-1-4-9-15)24(23-18)16-10-5-2-6-11-16/h1-13H,14H2,(H,21,25) |
| InChIKey | SZWACQIGHQJETQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |