C16H15BrN6OS2 — CID 21256987
2-[5-[2-(3-bromopropoxy)phenyl]-1,3,4-thiadiazol-2-yl]-5-prop-2-ynylsulfanyl-1,2,4-triazol-3-amine (PubChem CID 21256987) has the molecular formula C16H15BrN6OS2 and a molecular weight of 451.38 g/mol. Its IUPAC name is 2-[5-[2-(3-bromopropoxy)phenyl]-1,3,4-thiadiazol-2-yl]-5-prop-2-ynylsulfanyl-1,2,4-triazol-3-amine.
| Compound Name | 2-[5-[2-(3-bromopropoxy)phenyl]-1,3,4-thiadiazol-2-yl]-5-prop-2-ynylsulfanyl-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 21256987 |
| Molecular Formula | C16H15BrN6OS2 |
| Molecular Weight | 451.38 g/mol |
| Exact Mass | 449.99 |
| IUPAC Name | 2-[5-[2-(3-bromopropoxy)phenyl]-1,3,4-thiadiazol-2-yl]-5-prop-2-ynylsulfanyl-1,2,4-triazol-3-amine |
| SMILES | C#CCSc1nc(N)n(-c2nnc(-c3ccccc3OCCCBr)s2)n1 |
| InChI | InChI=1S/C16H15BrN6OS2/c1-2-10-25-15-19-14(18)23(22-15)16-21-20-13(26-16)11-6-3-4-7-12(11)24-9-5-8-17/h1,3-4,6-7H,5,8-10H2,(H2,18,19,22) |
| InChIKey | HMXDLHFLWRNBBT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|