About 6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine
6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine (PubChem CID 21257087) has the molecular formula C13H16FNO
and a molecular weight of 221.28 g/mol. Its IUPAC name is 6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine.
Molecular Properties
| Compound Name | 6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine |
| PubChem CID | 21257087 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine |
| SMILES | NC1CC2(CCCC2)Oc2ccc(F)cc21 |
| InChI | InChI=1S/C13H16FNO/c14-9-3-4-12-10(7-9)11(15)8-13(16-12)5-1-2-6-13/h3-4,7,11H,1-2,5-6,8,15H2 |
| InChIKey | AUNWIYCRCJHCCF-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine?
The IUPAC name of 6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine (CID 21257087) is 6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine.
What is the SMILES notation for 6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine?
The canonical SMILES for 6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine is NC1CC2(CCCC2)Oc2ccc(F)cc21.
What is the InChIKey of 6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine?
The InChIKey is AUNWIYCRCJHCCF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16FNO/c14-9-3-4-12-10(7-9)11(15)8-13(16-12)5-1-2-6-13/h3-4,7,11H,1-2,5-6,8,15H2.
What are the key properties of 6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine?
6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine has a molecular weight of 221.28 g/mol, XLogP of 2.92, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluorospiro[3,4-dihydrochromene-2,1'-cyclopentane]-4-amine is sourced from PubChem (CID 21257087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).