About 6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride
6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride (PubChem CID 21257103) has the molecular formula C11H15ClFNO
and a molecular weight of 231.70 g/mol. Its IUPAC name is 6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride.
Molecular Properties
| Compound Name | 6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride |
| PubChem CID | 21257103 |
| Molecular Formula | C11H15ClFNO |
| Molecular Weight | 231.70 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride |
| SMILES | CC1(C)CC(N)c2cc(F)ccc2O1.Cl |
| InChI | InChI=1S/C11H14FNO.ClH/c1-11(2)6-9(13)8-5-7(12)3-4-10(8)14-11;/h3-5,9H,6,13H2,1-2H3;1H |
| InChIKey | GHYIDVTWFWGMSW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.70 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride?
The IUPAC name of 6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride (CID 21257103) is 6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride.
What is the SMILES notation for 6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride?
The canonical SMILES for 6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride is CC1(C)CC(N)c2cc(F)ccc2O1.Cl.
What is the InChIKey of 6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride?
The InChIKey is GHYIDVTWFWGMSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO.ClH/c1-11(2)6-9(13)8-5-7(12)3-4-10(8)14-11;/h3-5,9H,6,13H2,1-2H3;1H.
What are the key properties of 6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride?
6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride has a molecular weight of 231.70 g/mol, XLogP of 2.81, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2,2-dimethyl-3,4-dihydrochromen-4-amine;hydrochloride is sourced from PubChem (CID 21257103), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).