About 3-(2-methylprop-1-enyl)pyrrolidine-2,5-dione
3-(2-methylprop-1-enyl)pyrrolidine-2,5-dione (PubChem CID 21257458) has the molecular formula C8H11NO2
and a molecular weight of 153.18 g/mol. Its IUPAC name is 3-(2-methylprop-1-enyl)pyrrolidine-2,5-dione.
Molecular Properties
| Compound Name | 3-(2-methylprop-1-enyl)pyrrolidine-2,5-dione |
| PubChem CID | 21257458 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | 3-(2-methylprop-1-enyl)pyrrolidine-2,5-dione |
| SMILES | CC(C)=CC1CC(=O)NC1=O |
| InChI | InChI=1S/C8H11NO2/c1-5(2)3-6-4-7(10)9-8(6)11/h3,6H,4H2,1-2H3,(H,9,10,11) |
| InChIKey | JTZKEVHEBCTHLN-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylprop-1-enyl)pyrrolidine-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylprop-1-enyl)pyrrolidine-2,5-dione?
The IUPAC name of 3-(2-methylprop-1-enyl)pyrrolidine-2,5-dione (CID 21257458) is 3-(2-methylprop-1-enyl)pyrrolidine-2,5-dione.
What is the SMILES notation for 3-(2-methylprop-1-enyl)pyrrolidine-2,5-dione?
The canonical SMILES for 3-(2-methylprop-1-enyl)pyrrolidine-2,5-dione is CC(C)=CC1CC(=O)NC1=O.
What is the InChIKey of 3-(2-methylprop-1-enyl)pyrrolidine-2,5-dione?
The InChIKey is JTZKEVHEBCTHLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2/c1-5(2)3-6-4-7(10)9-8(6)11/h3,6H,4H2,1-2H3,(H,9,10,11).
What are the key properties of 3-(2-methylprop-1-enyl)pyrrolidine-2,5-dione?
3-(2-methylprop-1-enyl)pyrrolidine-2,5-dione has a molecular weight of 153.18 g/mol, XLogP of 0.62, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylprop-1-enyl)pyrrolidine-2,5-dione is sourced from PubChem (CID 21257458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).