C18H7Cl2I3N2O5 — CID 21257692
5-[acetyl-(1,3-dioxoisoindol-2-yl)amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride (PubChem CID 21257692) has the molecular formula C18H7Cl2I3N2O5 and a molecular weight of 782.88 g/mol. Its IUPAC name is 5-[acetyl-(1,3-dioxoisoindol-2-yl)amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride.
| Compound Name | 5-[acetyl-(1,3-dioxoisoindol-2-yl)amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride |
|---|---|
| PubChem CID | 21257692 |
| Molecular Formula | C18H7Cl2I3N2O5 |
| Molecular Weight | 782.88 g/mol |
| Exact Mass | 781.69 |
| IUPAC Name | 5-[acetyl-(1,3-dioxoisoindol-2-yl)amino]-2,4,6-triiodobenzene-1,3-dicarbonyl chloride |
| SMILES | CC(=O)N(c1c(I)c(C(=O)Cl)c(I)c(C(=O)Cl)c1I)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H7Cl2I3N2O5/c1-6(26)24(25-17(29)7-4-2-3-5-8(7)18(25)30)14-12(22)9(15(19)27)11(21)10(13(14)23)16(20)28/h2-5H,1H3 |
| InChIKey | LLZQBKLGGOTHJL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.88 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|