About 2-[4-[1-[3,5-diethyl-4-(2-hydroxyethoxy)phenyl]cyclooctyl]-2,6-diethylphenoxy]ethanol
2-[4-[1-[3,5-diethyl-4-(2-hydroxyethoxy)phenyl]cyclooctyl]-2,6-diethylphenoxy]ethanol (PubChem CID 21257857) has the molecular formula C32H48O4
and a molecular weight of 496.73 g/mol. Its IUPAC name is 2-[4-[1-[3,5-diethyl-4-(2-hydroxyethoxy)phenyl]cyclooctyl]-2,6-diethylphenoxy]ethanol.
Molecular Properties
| Compound Name | 2-[4-[1-[3,5-diethyl-4-(2-hydroxyethoxy)phenyl]cyclooctyl]-2,6-diethylphenoxy]ethanol |
| PubChem CID | 21257857 |
| Molecular Formula | C32H48O4 |
| Molecular Weight | 496.73 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | 2-[4-[1-[3,5-diethyl-4-(2-hydroxyethoxy)phenyl]cyclooctyl]-2,6-diethylphenoxy]ethanol |
| SMILES | CCc1cc(C2(c3cc(CC)c(OCCO)c(CC)c3)CCCCCCC2)cc(CC)c1OCCO |
| InChI | InChI=1S/C32H48O4/c1-5-24-20-28(21-25(6-2)30(24)35-18-16-33)32(14-12-10-9-11-13-15-32)29-22-26(7-3)31(36-19-17-34)27(8-4)23-29/h20-23,33-34H,5-19H2,1-4H3 |
| InChIKey | KJLISYNBJVBOEU-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 496.73 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[1-[3,5-diethyl-4-(2-hydroxyethoxy)phenyl]cyclooctyl]-2,6-diethylphenoxy]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[1-[3,5-diethyl-4-(2-hydroxyethoxy)phenyl]cyclooctyl]-2,6-diethylphenoxy]ethanol?
The IUPAC name of 2-[4-[1-[3,5-diethyl-4-(2-hydroxyethoxy)phenyl]cyclooctyl]-2,6-diethylphenoxy]ethanol (CID 21257857) is 2-[4-[1-[3,5-diethyl-4-(2-hydroxyethoxy)phenyl]cyclooctyl]-2,6-diethylphenoxy]ethanol.
What is the SMILES notation for 2-[4-[1-[3,5-diethyl-4-(2-hydroxyethoxy)phenyl]cyclooctyl]-2,6-diethylphenoxy]ethanol?
The canonical SMILES for 2-[4-[1-[3,5-diethyl-4-(2-hydroxyethoxy)phenyl]cyclooctyl]-2,6-diethylphenoxy]ethanol is CCc1cc(C2(c3cc(CC)c(OCCO)c(CC)c3)CCCCCCC2)cc(CC)c1OCCO.
What is the InChIKey of 2-[4-[1-[3,5-diethyl-4-(2-hydroxyethoxy)phenyl]cyclooctyl]-2,6-diethylphenoxy]ethanol?
The InChIKey is KJLISYNBJVBOEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H48O4/c1-5-24-20-28(21-25(6-2)30(24)35-18-16-33)32(14-12-10-9-11-13-15-32)29-22-26(7-3)31(36-19-17-34)27(8-4)23-29/h20-23,33-34H,5-19H2,1-4H3.
What are the key properties of 2-[4-[1-[3,5-diethyl-4-(2-hydroxyethoxy)phenyl]cyclooctyl]-2,6-diethylphenoxy]ethanol?
2-[4-[1-[3,5-diethyl-4-(2-hydroxyethoxy)phenyl]cyclooctyl]-2,6-diethylphenoxy]ethanol has a molecular weight of 496.73 g/mol, XLogP of 6.71, 12 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[1-[3,5-diethyl-4-(2-hydroxyethoxy)phenyl]cyclooctyl]-2,6-diethylphenoxy]ethanol is sourced from PubChem (CID 21257857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).