About 4-(4-methoxyphenyl)butyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate
4-(4-methoxyphenyl)butyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate (PubChem CID 21258256) has the molecular formula C28H35NO8
and a molecular weight of 513.59 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)butyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate.
Molecular Properties
| Compound Name | 4-(4-methoxyphenyl)butyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate |
| PubChem CID | 21258256 |
| Molecular Formula | C28H35NO8 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.24 |
| IUPAC Name | 4-(4-methoxyphenyl)butyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate |
| SMILES | COc1ccc(CCCCOC(=O)C2CCCCN2C(=O)C(=O)c2cc(OC)c(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C28H35NO8/c1-33-21-13-11-19(12-14-21)9-6-8-16-37-28(32)22-10-5-7-15-29(22)27(31)25(30)20-17-23(34-2)26(36-4)24(18-20)35-3/h11-14,17-18,22H,5-10,15-16H2,1-4H3 |
| InChIKey | NWSGIROGLYHFFP-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methoxyphenyl)butyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methoxyphenyl)butyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate?
The IUPAC name of 4-(4-methoxyphenyl)butyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate (CID 21258256) is 4-(4-methoxyphenyl)butyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate.
What is the SMILES notation for 4-(4-methoxyphenyl)butyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate?
The canonical SMILES for 4-(4-methoxyphenyl)butyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate is COc1ccc(CCCCOC(=O)C2CCCCN2C(=O)C(=O)c2cc(OC)c(OC)c(OC)c2)cc1.
What is the InChIKey of 4-(4-methoxyphenyl)butyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate?
The InChIKey is NWSGIROGLYHFFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H35NO8/c1-33-21-13-11-19(12-14-21)9-6-8-16-37-28(32)22-10-5-7-15-29(22)27(31)25(30)20-17-23(34-2)26(36-4)24(18-20)35-3/h11-14,17-18,22H,5-10,15-16H2,1-4H3.
What are the key properties of 4-(4-methoxyphenyl)butyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate?
4-(4-methoxyphenyl)butyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate has a molecular weight of 513.59 g/mol, XLogP of 3.85, 12 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methoxyphenyl)butyl 1-[2-oxo-2-(3,4,5-trimethoxyphenyl)acetyl]piperidine-2-carboxylate is sourced from PubChem (CID 21258256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).