C11H18N2O — CID 21258616
(5E)-5-methoxyimino-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine (PubChem CID 21258616) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is (5E)-5-methoxyimino-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine.
| Compound Name | (5E)-5-methoxyimino-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine |
|---|---|
| PubChem CID | 21258616 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | (5E)-5-methoxyimino-2,3,4,6,7,8-hexahydro-1H-naphthalen-2-amine |
| SMILES | CO/N=C1\CCCC2=C1CCC(N)C2 |
| InChI | InChI=1S/C11H18N2O/c1-14-13-11-4-2-3-8-7-9(12)5-6-10(8)11/h9H,2-7,12H2,1H3/b13-11+ |
| InChIKey | ZULROOLMNAZAMW-ACCUITESSA-N |
| XLogP | 1.98 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|