C9H21N3O4 — CID 21259569
1,1-bis[2-(2-hydroxyethoxy)ethyl]guanidine (PubChem CID 21259569) has the molecular formula C9H21N3O4 and a molecular weight of 235.28 g/mol. Its IUPAC name is 1,1-bis[2-(2-hydroxyethoxy)ethyl]guanidine.
| Compound Name | 1,1-bis[2-(2-hydroxyethoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 21259569 |
| Molecular Formula | C9H21N3O4 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.15 |
| IUPAC Name | 1,1-bis[2-(2-hydroxyethoxy)ethyl]guanidine |
| SMILES | [H]/N=C(\N)N(CCOCCO)CCOCCO |
| InChI | InChI=1S/C9H21N3O4/c10-9(11)12(1-5-15-7-3-13)2-6-16-8-4-14/h13-14H,1-8H2,(H3,10,11) |
| InChIKey | GUUSKHSSRVTYNJ-UHFFFAOYSA-N |
| XLogP | -1.80 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | -1.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|