C17H6F12O13S4 — CID 21259743
[4-[2,3,4-tris(trifluoromethylsulfonyloxy)benzoyl]phenyl] trifluoromethanesulfonate (PubChem CID 21259743) has the molecular formula C17H6F12O13S4 and a molecular weight of 774.47 g/mol. Its IUPAC name is [4-[2,3,4-tris(trifluoromethylsulfonyloxy)benzoyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [4-[2,3,4-tris(trifluoromethylsulfonyloxy)benzoyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 21259743 |
| Molecular Formula | C17H6F12O13S4 |
| Molecular Weight | 774.47 g/mol |
| Exact Mass | 773.85 |
| IUPAC Name | [4-[2,3,4-tris(trifluoromethylsulfonyloxy)benzoyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=C(c1ccc(OS(=O)(=O)C(F)(F)F)cc1)c1ccc(OS(=O)(=O)C(F)(F)F)c(OS(=O)(=O)C(F)(F)F)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C17H6F12O13S4/c18-14(19,20)43(31,32)39-8-3-1-7(2-4-8)11(30)9-5-6-10(40-44(33,34)15(21,22)23)13(42-46(37,38)17(27,28)29)12(9)41-45(35,36)16(24,25)26/h1-6H |
| InChIKey | NAEXHPJSNMEXSU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 190.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 774.47 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|