About 1-hydroxypyrimidin-4-one
1-hydroxypyrimidin-4-one (PubChem CID 21259822) has the molecular formula C4H4N2O2
and a molecular weight of 112.09 g/mol. Its IUPAC name is 1-hydroxypyrimidin-4-one.
Molecular Properties
| Compound Name | 1-hydroxypyrimidin-4-one |
| PubChem CID | 21259822 |
| Molecular Formula | C4H4N2O2 |
| Molecular Weight | 112.09 g/mol |
| Exact Mass | 112.03 |
| IUPAC Name | 1-hydroxypyrimidin-4-one |
| SMILES | O=c1ccn(O)cn1 |
| InChI | InChI=1S/C4H4N2O2/c7-4-1-2-6(8)3-5-4/h1-3,8H |
| InChIKey | ZBBCMFUNRBNAMI-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.09 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxypyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxypyrimidin-4-one?
The IUPAC name of 1-hydroxypyrimidin-4-one (CID 21259822) is 1-hydroxypyrimidin-4-one.
What is the SMILES notation for 1-hydroxypyrimidin-4-one?
The canonical SMILES for 1-hydroxypyrimidin-4-one is O=c1ccn(O)cn1.
What is the InChIKey of 1-hydroxypyrimidin-4-one?
The InChIKey is ZBBCMFUNRBNAMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2/c7-4-1-2-6(8)3-5-4/h1-3,8H.
What are the key properties of 1-hydroxypyrimidin-4-one?
1-hydroxypyrimidin-4-one has a molecular weight of 112.09 g/mol, XLogP of -0.52, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxypyrimidin-4-one is sourced from PubChem (CID 21259822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).