About (4-oxo-1-pyridinyl) 1-phenylpropan-2-yl carbonate
(4-oxo-1-pyridinyl) 1-phenylpropan-2-yl carbonate (PubChem CID 21259829) has the molecular formula C15H15NO4
and a molecular weight of 273.29 g/mol. Its IUPAC name is (4-oxo-1-pyridinyl) 1-phenylpropan-2-yl carbonate.
Molecular Properties
| Compound Name | (4-oxo-1-pyridinyl) 1-phenylpropan-2-yl carbonate |
| PubChem CID | 21259829 |
| Molecular Formula | C15H15NO4 |
| Molecular Weight | 273.29 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (4-oxo-1-pyridinyl) 1-phenylpropan-2-yl carbonate |
| SMILES | CC(Cc1ccccc1)OC(=O)On1ccc(=O)cc1 |
| InChI | InChI=1S/C15H15NO4/c1-12(11-13-5-3-2-4-6-13)19-15(18)20-16-9-7-14(17)8-10-16/h2-10,12H,11H2,1H3 |
| InChIKey | NBNKDTHHXLTMOG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-oxo-1-pyridinyl) 1-phenylpropan-2-yl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-oxo-1-pyridinyl) 1-phenylpropan-2-yl carbonate?
The IUPAC name of (4-oxo-1-pyridinyl) 1-phenylpropan-2-yl carbonate (CID 21259829) is (4-oxo-1-pyridinyl) 1-phenylpropan-2-yl carbonate.
What is the SMILES notation for (4-oxo-1-pyridinyl) 1-phenylpropan-2-yl carbonate?
The canonical SMILES for (4-oxo-1-pyridinyl) 1-phenylpropan-2-yl carbonate is CC(Cc1ccccc1)OC(=O)On1ccc(=O)cc1.
What is the InChIKey of (4-oxo-1-pyridinyl) 1-phenylpropan-2-yl carbonate?
The InChIKey is NBNKDTHHXLTMOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NO4/c1-12(11-13-5-3-2-4-6-13)19-15(18)20-16-9-7-14(17)8-10-16/h2-10,12H,11H2,1H3.
What are the key properties of (4-oxo-1-pyridinyl) 1-phenylpropan-2-yl carbonate?
(4-oxo-1-pyridinyl) 1-phenylpropan-2-yl carbonate has a molecular weight of 273.29 g/mol, XLogP of 2.04, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-oxo-1-pyridinyl) 1-phenylpropan-2-yl carbonate is sourced from PubChem (CID 21259829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).