About [4-benzoyl-2,3-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate
[4-benzoyl-2,3-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate (PubChem CID 21259830) has the molecular formula C16H7F9O10S3
and a molecular weight of 626.41 g/mol. Its IUPAC name is [4-benzoyl-2,3-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-benzoyl-2,3-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
| PubChem CID | 21259830 |
| Molecular Formula | C16H7F9O10S3 |
| Molecular Weight | 626.41 g/mol |
| Exact Mass | 625.91 |
| IUPAC Name | [4-benzoyl-2,3-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate |
| SMILES | O=C(c1ccccc1)c1ccc(OS(=O)(=O)C(F)(F)F)c(OS(=O)(=O)C(F)(F)F)c1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C16H7F9O10S3/c17-14(18,19)36(27,28)33-10-7-6-9(11(26)8-4-2-1-3-5-8)12(34-37(29,30)15(20,21)22)13(10)35-38(31,32)16(23,24)25/h1-7H |
| InChIKey | AOIJMHJDYWIXDH-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 147.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 626.41 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-benzoyl-2,3-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-benzoyl-2,3-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate?
The IUPAC name of [4-benzoyl-2,3-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate (CID 21259830) is [4-benzoyl-2,3-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-benzoyl-2,3-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-benzoyl-2,3-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate is O=C(c1ccccc1)c1ccc(OS(=O)(=O)C(F)(F)F)c(OS(=O)(=O)C(F)(F)F)c1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [4-benzoyl-2,3-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate?
The InChIKey is AOIJMHJDYWIXDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H7F9O10S3/c17-14(18,19)36(27,28)33-10-7-6-9(11(26)8-4-2-1-3-5-8)12(34-37(29,30)15(20,21)22)13(10)35-38(31,32)16(23,24)25/h1-7H.
What are the key properties of [4-benzoyl-2,3-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate?
[4-benzoyl-2,3-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate has a molecular weight of 626.41 g/mol, XLogP of 3.60, 8 rotatable bonds, 0 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for [4-benzoyl-2,3-bis(trifluoromethylsulfonyloxy)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 21259830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).