C24H16NO8+ — CID 21259887
1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)-1-hydroxypyrrolidin-1-ium-2,5-dione (PubChem CID 21259887) has the molecular formula C24H16NO8+ and a molecular weight of 446.39 g/mol. Its IUPAC name is 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)-1-hydroxypyrrolidin-1-ium-2,5-dione.
| Compound Name | 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)-1-hydroxypyrrolidin-1-ium-2,5-dione |
|---|---|
| PubChem CID | 21259887 |
| Molecular Formula | C24H16NO8+ |
| Molecular Weight | 446.39 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 1-(3',6'-dihydroxy-3-oxospiro[2-benzofuran-1,9'-xanthene]-4-yl)-1-hydroxypyrrolidin-1-ium-2,5-dione |
| SMILES | O=C1OC2(c3ccc(O)cc3Oc3cc(O)ccc32)c2cccc([N+]3(O)C(=O)CCC3=O)c21 |
| InChI | InChI=1S/C24H15NO8/c26-12-4-6-14-18(10-12)32-19-11-13(27)5-7-15(19)24(14)16-2-1-3-17(22(16)23(30)33-24)25(31)20(28)8-9-21(25)29/h1-7,10-11,31H,8-9H2,(H-,26,27)/p+1 |
| InChIKey | NCXJIMJTBXMASF-UHFFFAOYSA-O |
| XLogP | 3.21 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.39 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|