C24H36Si — CID 21261176
bis(2-ethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilane (PubChem CID 21261176) has the molecular formula C24H36Si and a molecular weight of 352.64 g/mol. Its IUPAC name is bis(2-ethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilane.
| Compound Name | bis(2-ethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 21261176 |
| Molecular Formula | C24H36Si |
| Molecular Weight | 352.64 g/mol |
| Exact Mass | 352.26 |
| IUPAC Name | bis(2-ethyl-2,3,3a,7a-tetrahydro-1H-inden-1-yl)-dimethylsilane |
| SMILES | CCC1CC2C=CC=CC2C1[Si](C)(C)C1C(CC)CC2C=CC=CC21 |
| InChI | InChI=1S/C24H36Si/c1-5-17-15-19-11-7-9-13-21(19)23(17)25(3,4)24-18(6-2)16-20-12-8-10-14-22(20)24/h7-14,17-24H,5-6,15-16H2,1-4H3 |
| InChIKey | BZRDMIWSFGCKEM-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.64 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|