C13H26O2 — CID 21261663
(E)-5,5,9-trimethyldec-7-ene-1,9-diol (PubChem CID 21261663) has the molecular formula C13H26O2 and a molecular weight of 214.35 g/mol. Its IUPAC name is (E)-5,5,9-trimethyldec-7-ene-1,9-diol.
| Compound Name | (E)-5,5,9-trimethyldec-7-ene-1,9-diol |
|---|---|
| PubChem CID | 21261663 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | (E)-5,5,9-trimethyldec-7-ene-1,9-diol |
| SMILES | CC(C)(O)/C=C/CC(C)(C)CCCCO |
| InChI | InChI=1S/C13H26O2/c1-12(2,8-5-6-11-14)9-7-10-13(3,4)15/h7,10,14-15H,5-6,8-9,11H2,1-4H3/b10-7+ |
| InChIKey | OTERPQDRGJMTDX-JXMROGBWSA-N |
| XLogP | 2.89 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|