6-methoxypyrene-1,2,3-trisulfonic acid

C17H12O10S3 — CID 21262168

IUPAC6-methoxypyrene-1,2,3-trisulfonic acid
SMILESCOc1ccc2ccc3c(S(=O)(=O)O)c(S(=O)(=O)O)c(S(=O)(=O)O)c4ccc1c2c34
InChIInChI=1S/C17H12O10S3/c1-27-12-7-3-8-2-4-10-14-11(6-5-9(12)13(8)14)16(29(21,22)23)17(30(24,25)26)15(10)28(18,19)20/h2-7H,1H3,(H,18,19,20)(H,21,22,23)(H,24,25,26)
InChIKeyPXSPIGXGVJFGIZ-UHFFFAOYSA-N
MW472.47 g/mol
LogP2.33
Rot. Bonds4

About 6-methoxypyrene-1,2,3-trisulfonic acid

6-methoxypyrene-1,2,3-trisulfonic acid (PubChem CID 21262168) has the molecular formula C17H12O10S3 and a molecular weight of 472.47 g/mol. Its IUPAC name is 6-methoxypyrene-1,2,3-trisulfonic acid.

Molecular Properties

Compound Name6-methoxypyrene-1,2,3-trisulfonic acid
PubChem CID21262168
Molecular FormulaC17H12O10S3
Molecular Weight472.47 g/mol
Exact Mass471.96
IUPAC Name6-methoxypyrene-1,2,3-trisulfonic acid
SMILESCOc1ccc2ccc3c(S(=O)(=O)O)c(S(=O)(=O)O)c(S(=O)(=O)O)c4ccc1c2c34
InChIInChI=1S/C17H12O10S3/c1-27-12-7-3-8-2-4-10-14-11(6-5-9(12)13(8)14)16(29(21,22)23)17(30(24,25)26)15(10)28(18,19)20/h2-7H,1H3,(H,18,19,20)(H,21,22,23)(H,24,25,26)
InChIKeyPXSPIGXGVJFGIZ-UHFFFAOYSA-N
XLogP2.33
TPSA172.34 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds4
Heavy Atoms30
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500472.47
LogP ≤ 52.33
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 6-methoxypyrene-1,2,3-trisulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-methoxypyrene-1,2,3-trisulfonic acid?
The IUPAC name of 6-methoxypyrene-1,2,3-trisulfonic acid (CID 21262168) is 6-methoxypyrene-1,2,3-trisulfonic acid.
What is the SMILES notation for 6-methoxypyrene-1,2,3-trisulfonic acid?
The canonical SMILES for 6-methoxypyrene-1,2,3-trisulfonic acid is COc1ccc2ccc3c(S(=O)(=O)O)c(S(=O)(=O)O)c(S(=O)(=O)O)c4ccc1c2c34.
What is the InChIKey of 6-methoxypyrene-1,2,3-trisulfonic acid?
The InChIKey is PXSPIGXGVJFGIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O10S3/c1-27-12-7-3-8-2-4-10-14-11(6-5-9(12)13(8)14)16(29(21,22)23)17(30(24,25)26)15(10)28(18,19)20/h2-7H,1H3,(H,18,19,20)(H,21,22,23)(H,24,25,26).
What are the key properties of 6-methoxypyrene-1,2,3-trisulfonic acid?
6-methoxypyrene-1,2,3-trisulfonic acid has a molecular weight of 472.47 g/mol, XLogP of 2.33, 4 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxypyrene-1,2,3-trisulfonic acid is sourced from PubChem (CID 21262168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).