C10H19N2O3+ — CID 21262198
(1-amino-1-carboxybutan-2-yl)-dimethyl-prop-2-enoylazanium (PubChem CID 21262198) has the molecular formula C10H19N2O3+ and a molecular weight of 215.27 g/mol. Its IUPAC name is (1-amino-1-carboxybutan-2-yl)-dimethyl-prop-2-enoylazanium.
| Compound Name | (1-amino-1-carboxybutan-2-yl)-dimethyl-prop-2-enoylazanium |
|---|---|
| PubChem CID | 21262198 |
| Molecular Formula | C10H19N2O3+ |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | (1-amino-1-carboxybutan-2-yl)-dimethyl-prop-2-enoylazanium |
| SMILES | C=CC(=O)[N+](C)(C)C(CC)C(N)C(=O)O |
| InChI | InChI=1S/C10H18N2O3/c1-5-7(9(11)10(14)15)12(3,4)8(13)6-2/h6-7,9H,2,5,11H2,1,3-4H3/p+1 |
| InChIKey | FUUXBLPHDPSMHN-UHFFFAOYSA-O |
| XLogP | -0.03 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|