About 5,7-dibromoimidazo[5,1-b][1,3]thiazole
5,7-dibromoimidazo[5,1-b][1,3]thiazole (PubChem CID 21262441) has the molecular formula C5H2Br2N2S
and a molecular weight of 281.96 g/mol. Its IUPAC name is 5,7-dibromoimidazo[5,1-b][1,3]thiazole.
Molecular Properties
| Compound Name | 5,7-dibromoimidazo[5,1-b][1,3]thiazole |
|---|
| PubChem CID | 21262441 |
|---|
| Molecular Formula | C5H2Br2N2S |
|---|
| Molecular Weight | 281.96 g/mol |
|---|
| Exact Mass | 279.83 |
|---|
| IUPAC Name | 5,7-dibromoimidazo[5,1-b][1,3]thiazole |
|---|
| SMILES | Brc1nc(Br)n2ccsc12 |
|---|
| InChI | InChI=1S/C5H2Br2N2S/c6-3-4-9(1-2-10-4)5(7)8-3/h1-2H |
|---|
| InChIKey | XONJQWXYPFMMAC-UHFFFAOYSA-N |
|---|
| XLogP | 2.92 |
|---|
| TPSA | 17.30 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | 3 |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 10 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 281.96 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,7-dibromoimidazo[5,1-b][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dibromoimidazo[5,1-b][1,3]thiazole?
The IUPAC name of 5,7-dibromoimidazo[5,1-b][1,3]thiazole (CID 21262441) is 5,7-dibromoimidazo[5,1-b][1,3]thiazole.
What is the SMILES notation for 5,7-dibromoimidazo[5,1-b][1,3]thiazole?
The canonical SMILES for 5,7-dibromoimidazo[5,1-b][1,3]thiazole is Brc1nc(Br)n2ccsc12.
What is the InChIKey of 5,7-dibromoimidazo[5,1-b][1,3]thiazole?
The InChIKey is XONJQWXYPFMMAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H2Br2N2S/c6-3-4-9(1-2-10-4)5(7)8-3/h1-2H.
What are the key properties of 5,7-dibromoimidazo[5,1-b][1,3]thiazole?
5,7-dibromoimidazo[5,1-b][1,3]thiazole has a molecular weight of 281.96 g/mol, XLogP of 2.92, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dibromoimidazo[5,1-b][1,3]thiazole is sourced from PubChem (CID 21262441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).