About ethyl (2E)-2-[(3,5-dichlorophenyl)hydrazinylidene]propanoate
ethyl (2E)-2-[(3,5-dichlorophenyl)hydrazinylidene]propanoate (PubChem CID 21263362) has the molecular formula C11H12Cl2N2O2
and a molecular weight of 275.13 g/mol. Its IUPAC name is ethyl (2E)-2-[(3,5-dichlorophenyl)hydrazinylidene]propanoate.
Molecular Properties
| Compound Name | ethyl (2E)-2-[(3,5-dichlorophenyl)hydrazinylidene]propanoate |
| PubChem CID | 21263362 |
| Molecular Formula | C11H12Cl2N2O2 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | ethyl (2E)-2-[(3,5-dichlorophenyl)hydrazinylidene]propanoate |
| SMILES | CCOC(=O)/C(C)=N/Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C11H12Cl2N2O2/c1-3-17-11(16)7(2)14-15-10-5-8(12)4-9(13)6-10/h4-6,15H,3H2,1-2H3/b14-7+ |
| InChIKey | DYHLGDFFRYBLBD-VGOFMYFVSA-N |
| XLogP | 3.34 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2E)-2-[(3,5-dichlorophenyl)hydrazinylidene]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2E)-2-[(3,5-dichlorophenyl)hydrazinylidene]propanoate?
The IUPAC name of ethyl (2E)-2-[(3,5-dichlorophenyl)hydrazinylidene]propanoate (CID 21263362) is ethyl (2E)-2-[(3,5-dichlorophenyl)hydrazinylidene]propanoate.
What is the SMILES notation for ethyl (2E)-2-[(3,5-dichlorophenyl)hydrazinylidene]propanoate?
The canonical SMILES for ethyl (2E)-2-[(3,5-dichlorophenyl)hydrazinylidene]propanoate is CCOC(=O)/C(C)=N/Nc1cc(Cl)cc(Cl)c1.
What is the InChIKey of ethyl (2E)-2-[(3,5-dichlorophenyl)hydrazinylidene]propanoate?
The InChIKey is DYHLGDFFRYBLBD-VGOFMYFVSA-N. The full InChI is InChI=1S/C11H12Cl2N2O2/c1-3-17-11(16)7(2)14-15-10-5-8(12)4-9(13)6-10/h4-6,15H,3H2,1-2H3/b14-7+.
What are the key properties of ethyl (2E)-2-[(3,5-dichlorophenyl)hydrazinylidene]propanoate?
ethyl (2E)-2-[(3,5-dichlorophenyl)hydrazinylidene]propanoate has a molecular weight of 275.13 g/mol, XLogP of 3.34, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2E)-2-[(3,5-dichlorophenyl)hydrazinylidene]propanoate is sourced from PubChem (CID 21263362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).