C2HF4O3S- — CID 21263465
1,1,2,2-tetrafluoroethanesulfonate (PubChem CID 21263465) has the molecular formula C2HF4O3S- and a molecular weight of 181.09 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoroethanesulfonate.
| Compound Name | 1,1,2,2-tetrafluoroethanesulfonate |
|---|---|
| PubChem CID | 21263465 |
| Molecular Formula | C2HF4O3S- |
| Molecular Weight | 181.09 g/mol |
| Exact Mass | 180.96 |
| IUPAC Name | 1,1,2,2-tetrafluoroethanesulfonate |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)F |
| InChI | InChI=1S/C2H2F4O3S/c3-1(4)2(5,6)10(7,8)9/h1H,(H,7,8,9)/p-1 |
| InChIKey | KZWJWYFPLXRYIL-UHFFFAOYSA-M |
| XLogP | 0.39 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.09 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|