About methyl 2-cyanopentaneperoxoate
methyl 2-cyanopentaneperoxoate (PubChem CID 21263469) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is methyl 2-cyanopentaneperoxoate.
Molecular Properties
| Compound Name | methyl 2-cyanopentaneperoxoate |
| PubChem CID | 21263469 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | methyl 2-cyanopentaneperoxoate |
| SMILES | CCCC(C#N)C(=O)OOC |
| InChI | InChI=1S/C7H11NO3/c1-3-4-6(5-8)7(9)11-10-2/h6H,3-4H2,1-2H3 |
| InChIKey | XZPBZNAJYRVXMS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-cyanopentaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-cyanopentaneperoxoate?
The IUPAC name of methyl 2-cyanopentaneperoxoate (CID 21263469) is methyl 2-cyanopentaneperoxoate.
What is the SMILES notation for methyl 2-cyanopentaneperoxoate?
The canonical SMILES for methyl 2-cyanopentaneperoxoate is CCCC(C#N)C(=O)OOC.
What is the InChIKey of methyl 2-cyanopentaneperoxoate?
The InChIKey is XZPBZNAJYRVXMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-3-4-6(5-8)7(9)11-10-2/h6H,3-4H2,1-2H3.
What are the key properties of methyl 2-cyanopentaneperoxoate?
methyl 2-cyanopentaneperoxoate has a molecular weight of 157.17 g/mol, XLogP of 1.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-cyanopentaneperoxoate is sourced from PubChem (CID 21263469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).