C19H29NO6S — CID 21264515
5-[[2,2-dimethyl-4-(propylsulfonylamino)-3,4-dihydrochromen-6-yl]oxy]pentanoic acid (PubChem CID 21264515) has the molecular formula C19H29NO6S and a molecular weight of 399.51 g/mol. Its IUPAC name is 5-[[2,2-dimethyl-4-(propylsulfonylamino)-3,4-dihydrochromen-6-yl]oxy]pentanoic acid.
| Compound Name | 5-[[2,2-dimethyl-4-(propylsulfonylamino)-3,4-dihydrochromen-6-yl]oxy]pentanoic acid |
|---|---|
| PubChem CID | 21264515 |
| Molecular Formula | C19H29NO6S |
| Molecular Weight | 399.51 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 5-[[2,2-dimethyl-4-(propylsulfonylamino)-3,4-dihydrochromen-6-yl]oxy]pentanoic acid |
| SMILES | CCCS(=O)(=O)NC1CC(C)(C)Oc2ccc(OCCCCC(=O)O)cc21 |
| InChI | InChI=1S/C19H29NO6S/c1-4-11-27(23,24)20-16-13-19(2,3)26-17-9-8-14(12-15(16)17)25-10-6-5-7-18(21)22/h8-9,12,16,20H,4-7,10-11,13H2,1-3H3,(H,21,22) |
| InChIKey | KXONVAMTXBJBLG-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|