About magnesium bis(naphthalene-2-carboxylate)
magnesium bis(naphthalene-2-carboxylate) (PubChem CID 21264818) has the molecular formula C22H14MgO4
and a molecular weight of 366.66 g/mol. Its IUPAC name is magnesium bis(naphthalene-2-carboxylate).
Molecular Properties
| Compound Name | magnesium bis(naphthalene-2-carboxylate) |
| PubChem CID | 21264818 |
| Molecular Formula | C22H14MgO4 |
| Molecular Weight | 366.66 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | magnesium bis(naphthalene-2-carboxylate) |
| SMILES | O=C([O-])c1ccc2ccccc2c1.O=C([O-])c1ccc2ccccc2c1.[Mg+2] |
| InChI | InChI=1S/2C11H8O2.Mg/c2*12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;/h2*1-7H,(H,12,13);/q;;+2/p-2 |
| InChIKey | OFUAIAKLWWIPTC-UHFFFAOYSA-L |
| XLogP | 2.03 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.66 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze magnesium bis(naphthalene-2-carboxylate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(naphthalene-2-carboxylate)?
The IUPAC name of magnesium bis(naphthalene-2-carboxylate) (CID 21264818) is magnesium bis(naphthalene-2-carboxylate).
What is the SMILES notation for magnesium bis(naphthalene-2-carboxylate)?
The canonical SMILES for magnesium bis(naphthalene-2-carboxylate) is O=C([O-])c1ccc2ccccc2c1.O=C([O-])c1ccc2ccccc2c1.[Mg+2].
What is the InChIKey of magnesium bis(naphthalene-2-carboxylate)?
The InChIKey is OFUAIAKLWWIPTC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C11H8O2.Mg/c2*12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;/h2*1-7H,(H,12,13);/q;;+2/p-2.
What are the key properties of magnesium bis(naphthalene-2-carboxylate)?
magnesium bis(naphthalene-2-carboxylate) has a molecular weight of 366.66 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(naphthalene-2-carboxylate) is sourced from PubChem (CID 21264818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).