About [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium
[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium (PubChem CID 21265058) has the molecular formula C6H21N4P2+
and a molecular weight of 211.21 g/mol. Its IUPAC name is [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium.
Molecular Properties
| Compound Name | [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium |
| PubChem CID | 21265058 |
| Molecular Formula | C6H21N4P2+ |
| Molecular Weight | 211.21 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium |
| SMILES | CN(C)P(=N[PH3+])(N(C)C)N(C)C |
| InChI | InChI=1S/C6H20N4P2/c1-8(2)12(7-11,9(3)4)10(5)6/h11H2,1-6H3/p+1 |
| InChIKey | MTTIBZPCFOKBRO-UHFFFAOYSA-O |
| XLogP | 1.14 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium?
The IUPAC name of [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium (CID 21265058) is [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium.
What is the SMILES notation for [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium?
The canonical SMILES for [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium is CN(C)P(=N[PH3+])(N(C)C)N(C)C.
What is the InChIKey of [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium?
The InChIKey is MTTIBZPCFOKBRO-UHFFFAOYSA-O. The full InChI is InChI=1S/C6H20N4P2/c1-8(2)12(7-11,9(3)4)10(5)6/h11H2,1-6H3/p+1.
What are the key properties of [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium?
[[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium has a molecular weight of 211.21 g/mol, XLogP of 1.14, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [[tris(dimethylamino)-λ5-phosphanylidene]amino]phosphanium is sourced from PubChem (CID 21265058), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).