About 1-chloro-1,3,3-trifluoropropan-2-one
1-chloro-1,3,3-trifluoropropan-2-one (PubChem CID 21265068) has the molecular formula C3H2ClF3O
and a molecular weight of 146.50 g/mol. Its IUPAC name is 1-chloro-1,3,3-trifluoropropan-2-one.
Molecular Properties
| Compound Name | 1-chloro-1,3,3-trifluoropropan-2-one |
| PubChem CID | 21265068 |
| Molecular Formula | C3H2ClF3O |
| Molecular Weight | 146.50 g/mol |
| Exact Mass | 145.97 |
| IUPAC Name | 1-chloro-1,3,3-trifluoropropan-2-one |
| SMILES | O=C(C(F)F)C(F)Cl |
| InChI | InChI=1S/C3H2ClF3O/c4-2(5)1(8)3(6)7/h2-3H |
| InChIKey | BFYPRTKQTHBQMQ-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.50 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-1,3,3-trifluoropropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-1,3,3-trifluoropropan-2-one?
The IUPAC name of 1-chloro-1,3,3-trifluoropropan-2-one (CID 21265068) is 1-chloro-1,3,3-trifluoropropan-2-one.
What is the SMILES notation for 1-chloro-1,3,3-trifluoropropan-2-one?
The canonical SMILES for 1-chloro-1,3,3-trifluoropropan-2-one is O=C(C(F)F)C(F)Cl.
What is the InChIKey of 1-chloro-1,3,3-trifluoropropan-2-one?
The InChIKey is BFYPRTKQTHBQMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2ClF3O/c4-2(5)1(8)3(6)7/h2-3H.
What are the key properties of 1-chloro-1,3,3-trifluoropropan-2-one?
1-chloro-1,3,3-trifluoropropan-2-one has a molecular weight of 146.50 g/mol, XLogP of 1.36, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-1,3,3-trifluoropropan-2-one is sourced from PubChem (CID 21265068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).