About 2-acetylpropanedial
2-acetylpropanedial (PubChem CID 21265496) has the molecular formula C5H6O3
and a molecular weight of 114.10 g/mol. Its IUPAC name is 2-acetylpropanedial.
Molecular Properties
| Compound Name | 2-acetylpropanedial |
| PubChem CID | 21265496 |
| Molecular Formula | C5H6O3 |
| Molecular Weight | 114.10 g/mol |
| Exact Mass | 114.03 |
| IUPAC Name | 2-acetylpropanedial |
| SMILES | CC(=O)C(C=O)C=O |
| InChI | InChI=1S/C5H6O3/c1-4(8)5(2-6)3-7/h2-3,5H,1H3 |
| InChIKey | OKFAIMCETXZHTR-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.10 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-acetylpropanedial with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-acetylpropanedial?
The IUPAC name of 2-acetylpropanedial (CID 21265496) is 2-acetylpropanedial.
What is the SMILES notation for 2-acetylpropanedial?
The canonical SMILES for 2-acetylpropanedial is CC(=O)C(C=O)C=O.
What is the InChIKey of 2-acetylpropanedial?
The InChIKey is OKFAIMCETXZHTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3/c1-4(8)5(2-6)3-7/h2-3,5H,1H3.
What are the key properties of 2-acetylpropanedial?
2-acetylpropanedial has a molecular weight of 114.10 g/mol, XLogP of -0.41, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-acetylpropanedial is sourced from PubChem (CID 21265496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).