C16H18FN3O3Si — CID 21265530
2-[2-fluoro-5-methoxy-4-(2-trimethylsilylethynyl)phenyl]-4-methyl-1,2,4-triazine-3,5-dione (PubChem CID 21265530) has the molecular formula C16H18FN3O3Si and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[2-fluoro-5-methoxy-4-(2-trimethylsilylethynyl)phenyl]-4-methyl-1,2,4-triazine-3,5-dione.
| Compound Name | 2-[2-fluoro-5-methoxy-4-(2-trimethylsilylethynyl)phenyl]-4-methyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 21265530 |
| Molecular Formula | C16H18FN3O3Si |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 2-[2-fluoro-5-methoxy-4-(2-trimethylsilylethynyl)phenyl]-4-methyl-1,2,4-triazine-3,5-dione |
| SMILES | COc1cc(-n2ncc(=O)n(C)c2=O)c(F)cc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C16H18FN3O3Si/c1-19-15(21)10-18-20(16(19)22)13-9-14(23-2)11(8-12(13)17)6-7-24(3,4)5/h8-10H,1-5H3 |
| InChIKey | NFMMXPPMGRGCGR-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|