C25H24O4S — CID 21265698
dibenzyl 2-[(4-methylsulfanylphenyl)methyl]propanedioate (PubChem CID 21265698) has the molecular formula C25H24O4S and a molecular weight of 420.53 g/mol. Its IUPAC name is dibenzyl 2-[(4-methylsulfanylphenyl)methyl]propanedioate.
| Compound Name | dibenzyl 2-[(4-methylsulfanylphenyl)methyl]propanedioate |
|---|---|
| PubChem CID | 21265698 |
| Molecular Formula | C25H24O4S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | dibenzyl 2-[(4-methylsulfanylphenyl)methyl]propanedioate |
| SMILES | CSc1ccc(CC(C(=O)OCc2ccccc2)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H24O4S/c1-30-22-14-12-19(13-15-22)16-23(24(26)28-17-20-8-4-2-5-9-20)25(27)29-18-21-10-6-3-7-11-21/h2-15,23H,16-18H2,1H3 |
| InChIKey | RUVRQWHJCPIFMN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|